C24H26FN5O2 — CID 66781550
N-[(3S,4R)-3-fluoropiperidin-4-yl]-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinolin-8-amine (PubChem CID 66781550) has the molecular formula C24H26FN5O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is N-[(3S,4R)-3-fluoropiperidin-4-yl]-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinolin-8-amine.
| Compound Name | N-[(3S,4R)-3-fluoropiperidin-4-yl]-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinolin-8-amine |
|---|---|
| PubChem CID | 66781550 |
| Molecular Formula | C24H26FN5O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | N-[(3S,4R)-3-fluoropiperidin-4-yl]-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinolin-8-amine |
| SMILES | COCCOc1ccn2c(-c3ccc4cccc(N[C@@H]5CCNC[C@@H]5F)c4n3)cnc2c1 |
| InChI | InChI=1S/C24H26FN5O2/c1-31-11-12-32-17-8-10-30-22(15-27-23(30)13-17)20-6-5-16-3-2-4-21(24(16)29-20)28-19-7-9-26-14-18(19)25/h2-6,8,10,13,15,18-19,26,28H,7,9,11-12,14H2,1H3/t18-,19+/m0/s1 |
| InChIKey | HTQYVNDQWIJFQA-RBUKOAKNSA-N |
| XLogP | 3.69 |
| TPSA | 72.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|