C25H26F3N5O2 — CID 59363452
1-[2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-6-(trifluoromethyl)quinolin-8-yl]piperidin-4-amine (PubChem CID 59363452) has the molecular formula C25H26F3N5O2 and a molecular weight of 485.51 g/mol. Its IUPAC name is 1-[2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-6-(trifluoromethyl)quinolin-8-yl]piperidin-4-amine.
| Compound Name | 1-[2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-6-(trifluoromethyl)quinolin-8-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 59363452 |
| Molecular Formula | C25H26F3N5O2 |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | 1-[2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-6-(trifluoromethyl)quinolin-8-yl]piperidin-4-amine |
| SMILES | COCCOc1ccn2c(-c3ccc4cc(C(F)(F)F)cc(N5CCC(N)CC5)c4n3)cnc2c1 |
| InChI | InChI=1S/C25H26F3N5O2/c1-34-10-11-35-19-6-9-33-22(15-30-23(33)14-19)20-3-2-16-12-17(25(26,27)28)13-21(24(16)31-20)32-7-4-18(29)5-8-32/h2-3,6,9,12-15,18H,4-5,7-8,10-11,29H2,1H3 |
| InChIKey | CEPIRBIYIGKTPE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|