C24H26FN5O2 — CID 59363460
1-[5-fluoro-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinolin-8-yl]piperidin-4-amine (PubChem CID 59363460) has the molecular formula C24H26FN5O2 and a molecular weight of 435.50 g/mol. Its IUPAC name is 1-[5-fluoro-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinolin-8-yl]piperidin-4-amine.
| Compound Name | 1-[5-fluoro-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinolin-8-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 59363460 |
| Molecular Formula | C24H26FN5O2 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 1-[5-fluoro-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinolin-8-yl]piperidin-4-amine |
| SMILES | COCCOc1ccn2c(-c3ccc4c(F)ccc(N5CCC(N)CC5)c4n3)cnc2c1 |
| InChI | InChI=1S/C24H26FN5O2/c1-31-12-13-32-17-8-11-30-22(15-27-23(30)14-17)20-4-2-18-19(25)3-5-21(24(18)28-20)29-9-6-16(26)7-10-29/h2-5,8,11,14-16H,6-7,9-10,12-13,26H2,1H3 |
| InChIKey | BOTJKAMRTFPHCY-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 77.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|