C21H19N3O4 — CID 86638607
8-methoxy-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline-4-carbaldehyde (PubChem CID 86638607) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 8-methoxy-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline-4-carbaldehyde.
| Compound Name | 8-methoxy-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline-4-carbaldehyde |
|---|---|
| PubChem CID | 86638607 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 8-methoxy-2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]quinoline-4-carbaldehyde |
| SMILES | COCCOc1ccn2c(-c3cc(C=O)c4cccc(OC)c4n3)cnc2c1 |
| InChI | InChI=1S/C21H19N3O4/c1-26-8-9-28-15-6-7-24-18(12-22-20(24)11-15)17-10-14(13-25)16-4-3-5-19(27-2)21(16)23-17/h3-7,10-13H,8-9H2,1-2H3 |
| InChIKey | UCXYVGAAZZUQOU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|