C24H27N5O2 — CID 59363450
2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-8-[(3R)-3-methylpiperazin-1-yl]quinoline (PubChem CID 59363450) has the molecular formula C24H27N5O2 and a molecular weight of 417.51 g/mol. Its IUPAC name is 2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-8-[(3R)-3-methylpiperazin-1-yl]quinoline.
| Compound Name | 2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-8-[(3R)-3-methylpiperazin-1-yl]quinoline |
|---|---|
| PubChem CID | 59363450 |
| Molecular Formula | C24H27N5O2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | 2-[7-(2-methoxyethoxy)imidazo[1,2-a]pyridin-3-yl]-8-[(3R)-3-methylpiperazin-1-yl]quinoline |
| SMILES | COCCOc1ccn2c(-c3ccc4cccc(N5CCN[C@H](C)C5)c4n3)cnc2c1 |
| InChI | InChI=1S/C24H27N5O2/c1-17-16-28(11-9-25-17)21-5-3-4-18-6-7-20(27-24(18)21)22-15-26-23-14-19(8-10-29(22)23)31-13-12-30-2/h3-8,10,14-15,17,25H,9,11-13,16H2,1-2H3/t17-/m1/s1 |
| InChIKey | PFLOLESCTHVHMT-QGZVFWFLSA-N |
| XLogP | 3.37 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|