C20H32N5O7+ — CID 66781774
(2R)-2-[[(4R)-4,5-diamino-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid;tris(hydroxymethyl)-methylazanium (PubChem CID 66781774) has the molecular formula C20H32N5O7+ and a molecular weight of 454.50 g/mol. Its IUPAC name is (2R)-2-[[(4R)-4,5-diamino-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid;tris(hydroxymethyl)-methylazanium.
| Compound Name | (2R)-2-[[(4R)-4,5-diamino-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid;tris(hydroxymethyl)-methylazanium |
|---|---|
| PubChem CID | 66781774 |
| Molecular Formula | C20H32N5O7+ |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (2R)-2-[[(4R)-4,5-diamino-5-oxopentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid;tris(hydroxymethyl)-methylazanium |
| SMILES | C[N+](CO)(CO)CO.NC(=O)[C@H](N)CCC(=O)N[C@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N4O4.C4H12NO3/c17-11(15(18)22)5-6-14(21)20-13(16(23)24)7-9-8-19-12-4-2-1-3-10(9)12;1-5(2-6,3-7)4-8/h1-4,8,11,13,19H,5-7,17H2,(H2,18,22)(H,20,21)(H,23,24);6-8H,2-4H2,1H3/q;+1/t11-,13-;/m1./s1 |
| InChIKey | MWDTVCGXHJNIBA-LOCPCMAASA-N |
| XLogP | -1.85 |
| TPSA | 211.99 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|