C19H30N4O4S — CID 66784380
N-[3-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide (PubChem CID 66784380) has the molecular formula C19H30N4O4S and a molecular weight of 410.54 g/mol. Its IUPAC name is N-[3-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 66784380 |
| Molecular Formula | C19H30N4O4S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[3-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide |
| SMILES | CN1CCSC1=NNC(=O)C(=O)C(NC(=O)C1CCCCC1)C1CCOCC1 |
| InChI | InChI=1S/C19H30N4O4S/c1-23-9-12-28-19(23)22-21-18(26)16(24)15(13-7-10-27-11-8-13)20-17(25)14-5-3-2-4-6-14/h13-15H,2-12H2,1H3,(H,20,25)(H,21,26) |
| InChIKey | YHAQVYJQCKBEFT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|