C22H37ClN4O4S — CID 66785218
N-[3-[2-(3-tert-butyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide;hydrochloride (PubChem CID 66785218) has the molecular formula C22H37ClN4O4S and a molecular weight of 489.08 g/mol. Its IUPAC name is N-[3-[2-(3-tert-butyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide;hydrochloride.
| Compound Name | N-[3-[2-(3-tert-butyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide;hydrochloride |
|---|---|
| PubChem CID | 66785218 |
| Molecular Formula | C22H37ClN4O4S |
| Molecular Weight | 489.08 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | N-[3-[2-(3-tert-butyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide;hydrochloride |
| SMILES | CC(C)(C)N1CCSC1=NNC(=O)C(=O)C(NC(=O)C1CCCCC1)C1CCOCC1.Cl |
| InChI | InChI=1S/C22H36N4O4S.ClH/c1-22(2,3)26-11-14-31-21(26)25-24-20(29)18(27)17(15-9-12-30-13-10-15)23-19(28)16-7-5-4-6-8-16;/h15-17H,4-14H2,1-3H3,(H,23,28)(H,24,29);1H |
| InChIKey | GUMSNBYDPCWGFB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.08 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|