C23H40N4O3S — CID 172945656
N-[1-cyclohexyl-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]cycloheptanecarboxamide;ethane (PubChem CID 172945656) has the molecular formula C23H40N4O3S and a molecular weight of 452.67 g/mol. Its IUPAC name is N-[1-cyclohexyl-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]cycloheptanecarboxamide;ethane.
| Compound Name | N-[1-cyclohexyl-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]cycloheptanecarboxamide;ethane |
|---|---|
| PubChem CID | 172945656 |
| Molecular Formula | C23H40N4O3S |
| Molecular Weight | 452.67 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | N-[1-cyclohexyl-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]cycloheptanecarboxamide;ethane |
| SMILES | CC.CN1CCS/C1=N\NC(=O)C(=O)C(NC(=O)C1CCCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C21H34N4O3S.C2H6/c1-25-13-14-29-21(25)24-23-20(28)18(26)17(15-9-7-4-8-10-15)22-19(27)16-11-5-2-3-6-12-16;1-2/h15-17H,2-14H2,1H3,(H,22,27)(H,23,28);1-2H3/b24-21-; |
| InChIKey | DARZARRBYXTAIK-KKPJOBIBSA-N |
| XLogP | 3.68 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.67 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|