C20H33ClN4O3S — CID 87150538
(E)-N-[1-cyclohexyl-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]-4,4-dimethylpent-2-enamide;hydrochloride (PubChem CID 87150538) has the molecular formula C20H33ClN4O3S and a molecular weight of 445.03 g/mol. Its IUPAC name is (E)-N-[1-cyclohexyl-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]-4,4-dimethylpent-2-enamide;hydrochloride.
| Compound Name | (E)-N-[1-cyclohexyl-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]-4,4-dimethylpent-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 87150538 |
| Molecular Formula | C20H33ClN4O3S |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | (E)-N-[1-cyclohexyl-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]-4,4-dimethylpent-2-enamide;hydrochloride |
| SMILES | CN1CCS/C1=N\NC(=O)C(=O)C(NC(=O)/C=C/C(C)(C)C)C1CCCCC1.Cl |
| InChI | InChI=1S/C20H32N4O3S.ClH/c1-20(2,3)11-10-15(25)21-16(14-8-6-5-7-9-14)17(26)18(27)22-23-19-24(4)12-13-28-19;/h10-11,14,16H,5-9,12-13H2,1-4H3,(H,21,25)(H,22,27);1H/b11-10+,23-19-; |
| InChIKey | GNPKBJGNGBJPIL-LTDHXUKESA-N |
| XLogP | 2.71 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|