C26H38ClN5O5S2 — CID 87150034
N-[1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]cyclohexanecarboxamide;hydrochloride (PubChem CID 87150034) has the molecular formula C26H38ClN5O5S2 and a molecular weight of 600.21 g/mol. Its IUPAC name is N-[1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]cyclohexanecarboxamide;hydrochloride.
| Compound Name | N-[1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]cyclohexanecarboxamide;hydrochloride |
|---|---|
| PubChem CID | 87150034 |
| Molecular Formula | C26H38ClN5O5S2 |
| Molecular Weight | 600.21 g/mol |
| Exact Mass | 599.20 |
| IUPAC Name | N-[1-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]-3-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-2,3-dioxopropyl]cyclohexanecarboxamide;hydrochloride |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(C(NC(=O)C3CCCCC3)C(=O)C(=O)N/N=C3\SCCN3C)CC2)cc1.Cl |
| InChI | InChI=1S/C26H37N5O5S2.ClH/c1-18-8-10-21(11-9-18)38(35,36)31-14-12-19(13-15-31)22(27-24(33)20-6-4-3-5-7-20)23(32)25(34)28-29-26-30(2)16-17-37-26;/h8-11,19-20,22H,3-7,12-17H2,1-2H3,(H,27,33)(H,28,34);1H/b29-26-; |
| InChIKey | RXLCRRWZJMETOM-DJUUNRNFSA-N |
| XLogP | 2.52 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|