C15H24N4O2S — CID 142822936
N-[2-[[(Z)-(3-methyl-1,3-thiazolidin-2-ylidene)amino]carbamoyl]prop-2-enyl]cyclohexanecarboxamide (PubChem CID 142822936) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is N-[2-[[(Z)-(3-methyl-1,3-thiazolidin-2-ylidene)amino]carbamoyl]prop-2-enyl]cyclohexanecarboxamide.
| Compound Name | N-[2-[[(Z)-(3-methyl-1,3-thiazolidin-2-ylidene)amino]carbamoyl]prop-2-enyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 142822936 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | N-[2-[[(Z)-(3-methyl-1,3-thiazolidin-2-ylidene)amino]carbamoyl]prop-2-enyl]cyclohexanecarboxamide |
| SMILES | C=C(CNC(=O)C1CCCCC1)C(=O)N/N=C1\SCCN1C |
| InChI | InChI=1S/C15H24N4O2S/c1-11(10-16-14(21)12-6-4-3-5-7-12)13(20)17-18-15-19(2)8-9-22-15/h12H,1,3-10H2,2H3,(H,16,21)(H,17,20)/b18-15- |
| InChIKey | LEBGXCZCQOBECL-SDXDJHTJSA-N |
| XLogP | 1.30 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|