C21H36N4O3S — CID 87150028
N-[1-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxo-4-propylheptan-3-yl]cyclohexanecarboxamide (PubChem CID 87150028) has the molecular formula C21H36N4O3S and a molecular weight of 424.61 g/mol. Its IUPAC name is N-[1-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxo-4-propylheptan-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxo-4-propylheptan-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 87150028 |
| Molecular Formula | C21H36N4O3S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | N-[1-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxo-4-propylheptan-3-yl]cyclohexanecarboxamide |
| SMILES | CCCC(CCC)C(NC(=O)C1CCCCC1)C(=O)C(=O)N/N=C1\SCCN1C |
| InChI | InChI=1S/C21H36N4O3S/c1-4-9-15(10-5-2)17(22-19(27)16-11-7-6-8-12-16)18(26)20(28)23-24-21-25(3)13-14-29-21/h15-17H,4-14H2,1-3H3,(H,22,27)(H,23,28)/b24-21- |
| InChIKey | BINTWYVLFKAVAY-FLFQWRMESA-N |
| XLogP | 2.90 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|