C13H23ClN4O3S — CID 66784109
(3S)-3-acetamido-5-methyl-N-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]-2-oxohexanamide;hydrochloride (PubChem CID 66784109) has the molecular formula C13H23ClN4O3S and a molecular weight of 350.87 g/mol. Its IUPAC name is (3S)-3-acetamido-5-methyl-N-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]-2-oxohexanamide;hydrochloride.
| Compound Name | (3S)-3-acetamido-5-methyl-N-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]-2-oxohexanamide;hydrochloride |
|---|---|
| PubChem CID | 66784109 |
| Molecular Formula | C13H23ClN4O3S |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (3S)-3-acetamido-5-methyl-N-[(3-methyl-1,3-thiazolidin-2-ylidene)amino]-2-oxohexanamide;hydrochloride |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)C(=O)NN=C1SCCN1C.Cl |
| InChI | InChI=1S/C13H22N4O3S.ClH/c1-8(2)7-10(14-9(3)18)11(19)12(20)15-16-13-17(4)5-6-21-13;/h8,10H,5-7H2,1-4H3,(H,14,18)(H,15,20);1H/t10-;/m0./s1 |
| InChIKey | GLINFVUYKQNOHB-PPHPATTJSA-N |
| XLogP | 0.59 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|