C25H35N5O4S — CID 66784156
N-[1-[[5-methyl-1-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxohexan-3-yl]carbamoyl]cyclohexyl]benzamide (PubChem CID 66784156) has the molecular formula C25H35N5O4S and a molecular weight of 501.65 g/mol. Its IUPAC name is N-[1-[[5-methyl-1-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxohexan-3-yl]carbamoyl]cyclohexyl]benzamide.
| Compound Name | N-[1-[[5-methyl-1-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxohexan-3-yl]carbamoyl]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 66784156 |
| Molecular Formula | C25H35N5O4S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.24 |
| IUPAC Name | N-[1-[[5-methyl-1-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxohexan-3-yl]carbamoyl]cyclohexyl]benzamide |
| SMILES | CC(C)CC(NC(=O)C1(NC(=O)c2ccccc2)CCCCC1)C(=O)C(=O)NN=C1SCCN1C |
| InChI | InChI=1S/C25H35N5O4S/c1-17(2)16-19(20(31)22(33)28-29-24-30(3)14-15-35-24)26-23(34)25(12-8-5-9-13-25)27-21(32)18-10-6-4-7-11-18/h4,6-7,10-11,17,19H,5,8-9,12-16H2,1-3H3,(H,26,34)(H,27,32)(H,28,33) |
| InChIKey | ZUTIAJNSIMZQGP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|