C18H25ClN4O3S — CID 87464890
N-[(3S)-5-methyl-1-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxohexan-3-yl]benzamide;hydrochloride (PubChem CID 87464890) has the molecular formula C18H25ClN4O3S and a molecular weight of 412.94 g/mol. Its IUPAC name is N-[(3S)-5-methyl-1-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxohexan-3-yl]benzamide;hydrochloride.
| Compound Name | N-[(3S)-5-methyl-1-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxohexan-3-yl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 87464890 |
| Molecular Formula | C18H25ClN4O3S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[(3S)-5-methyl-1-[(2Z)-2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxohexan-3-yl]benzamide;hydrochloride |
| SMILES | CC(C)C[C@H](NC(=O)c1ccccc1)C(=O)C(=O)N/N=C1\SCCN1C.Cl |
| InChI | InChI=1S/C18H24N4O3S.ClH/c1-12(2)11-14(19-16(24)13-7-5-4-6-8-13)15(23)17(25)20-21-18-22(3)9-10-26-18;/h4-8,12,14H,9-11H2,1-3H3,(H,19,24)(H,20,25);1H/b21-18-;/t14-;/m0./s1 |
| InChIKey | PYQIOPKANNMUOA-KFTMVZTISA-N |
| XLogP | 1.89 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|