C23H36N4O3S — CID 66785513
N-[3-[2-[(7aR)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]hydrazinyl]-1-cyclohexyl-2,3-dioxopropyl]cycloheptanecarboxamide (PubChem CID 66785513) has the molecular formula C23H36N4O3S and a molecular weight of 448.63 g/mol. Its IUPAC name is N-[3-[2-[(7aR)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]hydrazinyl]-1-cyclohexyl-2,3-dioxopropyl]cycloheptanecarboxamide.
| Compound Name | N-[3-[2-[(7aR)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]hydrazinyl]-1-cyclohexyl-2,3-dioxopropyl]cycloheptanecarboxamide |
|---|---|
| PubChem CID | 66785513 |
| Molecular Formula | C23H36N4O3S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | N-[3-[2-[(7aR)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]hydrazinyl]-1-cyclohexyl-2,3-dioxopropyl]cycloheptanecarboxamide |
| SMILES | O=C(NN=C1SC[C@H]2CCCN12)C(=O)C(NC(=O)C1CCCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C23H36N4O3S/c28-20(22(30)25-26-23-27-14-8-13-18(27)15-31-23)19(16-9-6-3-7-10-16)24-21(29)17-11-4-1-2-5-12-17/h16-19H,1-15H2,(H,24,29)(H,25,30)/t18-,19?/m1/s1 |
| InChIKey | HRKLENSYBHAHFQ-MRTLOADZSA-N |
| XLogP | 3.19 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|