C21H32N4O4S — CID 66784883
N-[(1S)-3-[2-[(7aR)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide (PubChem CID 66784883) has the molecular formula C21H32N4O4S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-[(1S)-3-[2-[(7aR)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide.
| Compound Name | N-[(1S)-3-[2-[(7aR)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 66784883 |
| Molecular Formula | C21H32N4O4S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N-[(1S)-3-[2-[(7aR)-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]thiazol-3-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide |
| SMILES | O=C(NN=C1SC[C@H]2CCCN12)C(=O)[C@@H](NC(=O)C1CCCCC1)C1CCOCC1 |
| InChI | InChI=1S/C21H32N4O4S/c26-18(20(28)23-24-21-25-10-4-7-16(25)13-30-21)17(14-8-11-29-12-9-14)22-19(27)15-5-2-1-3-6-15/h14-17H,1-13H2,(H,22,27)(H,23,28)/t16-,17+/m1/s1 |
| InChIKey | RVBLSQIPWFXQRB-SJORKVTESA-N |
| XLogP | 1.65 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|