C25H34N4O4S — CID 87150172
N-[3-[(2Z)-2-[(4R)-3-methyl-4-phenyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide (PubChem CID 87150172) has the molecular formula C25H34N4O4S and a molecular weight of 486.64 g/mol. Its IUPAC name is N-[3-[(2Z)-2-[(4R)-3-methyl-4-phenyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[(2Z)-2-[(4R)-3-methyl-4-phenyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 87150172 |
| Molecular Formula | C25H34N4O4S |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-[3-[(2Z)-2-[(4R)-3-methyl-4-phenyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cyclohexanecarboxamide |
| SMILES | CN1/C(=N/NC(=O)C(=O)C(NC(=O)C2CCCCC2)C2CCOCC2)SC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H34N4O4S/c1-29-20(17-8-4-2-5-9-17)16-34-25(29)28-27-24(32)22(30)21(18-12-14-33-15-13-18)26-23(31)19-10-6-3-7-11-19/h2,4-5,8-9,18-21H,3,6-7,10-16H2,1H3,(H,26,31)(H,27,32)/b28-25-/t20-,21?/m0/s1 |
| InChIKey | CMQWGUXSUFXUDZ-MSKILZFGSA-N |
| XLogP | 2.85 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|