C28H39FN4O4S — CID 87150373
N-[(1R)-3-[(2Z)-2-[(4R)-4-ethyl-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cycloheptanecarboxamide (PubChem CID 87150373) has the molecular formula C28H39FN4O4S and a molecular weight of 546.71 g/mol. Its IUPAC name is N-[(1R)-3-[(2Z)-2-[(4R)-4-ethyl-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cycloheptanecarboxamide.
| Compound Name | N-[(1R)-3-[(2Z)-2-[(4R)-4-ethyl-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cycloheptanecarboxamide |
|---|---|
| PubChem CID | 87150373 |
| Molecular Formula | C28H39FN4O4S |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | N-[(1R)-3-[(2Z)-2-[(4R)-4-ethyl-3-[(4-fluorophenyl)methyl]-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cycloheptanecarboxamide |
| SMILES | CC[C@@H]1CS/C(=N\NC(=O)C(=O)[C@H](NC(=O)C2CCCCCC2)C2CCOCC2)N1Cc1ccc(F)cc1 |
| InChI | InChI=1S/C28H39FN4O4S/c1-2-23-18-38-28(33(23)17-19-9-11-22(29)12-10-19)32-31-27(36)25(34)24(20-13-15-37-16-14-20)30-26(35)21-7-5-3-4-6-8-21/h9-12,20-21,23-24H,2-8,13-18H2,1H3,(H,30,35)(H,31,36)/b32-28-/t23-,24-/m1/s1 |
| InChIKey | CLFDXNGOKFDING-QHZWIXGQSA-N |
| XLogP | 3.99 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|