C27H38N4O4S — CID 87150473
N-[(1R)-3-[(2Z)-2-[(5R)-3-benzyl-5-methyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cycloheptanecarboxamide (PubChem CID 87150473) has the molecular formula C27H38N4O4S and a molecular weight of 514.69 g/mol. Its IUPAC name is N-[(1R)-3-[(2Z)-2-[(5R)-3-benzyl-5-methyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cycloheptanecarboxamide.
| Compound Name | N-[(1R)-3-[(2Z)-2-[(5R)-3-benzyl-5-methyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cycloheptanecarboxamide |
|---|---|
| PubChem CID | 87150473 |
| Molecular Formula | C27H38N4O4S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | N-[(1R)-3-[(2Z)-2-[(5R)-3-benzyl-5-methyl-1,3-thiazolidin-2-ylidene]hydrazinyl]-1-(oxan-4-yl)-2,3-dioxopropyl]cycloheptanecarboxamide |
| SMILES | C[C@@H]1CN(Cc2ccccc2)/C(=N/NC(=O)C(=O)[C@H](NC(=O)C2CCCCCC2)C2CCOCC2)S1 |
| InChI | InChI=1S/C27H38N4O4S/c1-19-17-31(18-20-9-5-4-6-10-20)27(36-19)30-29-26(34)24(32)23(21-13-15-35-16-14-21)28-25(33)22-11-7-2-3-8-12-22/h4-6,9-10,19,21-23H,2-3,7-8,11-18H2,1H3,(H,28,33)(H,29,34)/b30-27-/t19-,23-/m1/s1 |
| InChIKey | VEWGPPOFSADXOK-CATZLHAKSA-N |
| XLogP | 3.46 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|