C29H45Cl2N5O3S — CID 66784213
N-[1-cyclohexyl-3-[2-[3-[[4-[(dimethylamino)methyl]phenyl]methyl]-1,3-thiazolidin-2-ylidene]hydrazinyl]-2,3-dioxopropyl]cyclohexanecarboxamide;dihydrochloride (PubChem CID 66784213) has the molecular formula C29H45Cl2N5O3S and a molecular weight of 614.68 g/mol. Its IUPAC name is N-[1-cyclohexyl-3-[2-[3-[[4-[(dimethylamino)methyl]phenyl]methyl]-1,3-thiazolidin-2-ylidene]hydrazinyl]-2,3-dioxopropyl]cyclohexanecarboxamide;dihydrochloride.
| Compound Name | N-[1-cyclohexyl-3-[2-[3-[[4-[(dimethylamino)methyl]phenyl]methyl]-1,3-thiazolidin-2-ylidene]hydrazinyl]-2,3-dioxopropyl]cyclohexanecarboxamide;dihydrochloride |
|---|---|
| PubChem CID | 66784213 |
| Molecular Formula | C29H45Cl2N5O3S |
| Molecular Weight | 614.68 g/mol |
| Exact Mass | 613.26 |
| IUPAC Name | N-[1-cyclohexyl-3-[2-[3-[[4-[(dimethylamino)methyl]phenyl]methyl]-1,3-thiazolidin-2-ylidene]hydrazinyl]-2,3-dioxopropyl]cyclohexanecarboxamide;dihydrochloride |
| SMILES | CN(C)Cc1ccc(CN2CCSC2=NNC(=O)C(=O)C(NC(=O)C2CCCCC2)C2CCCCC2)cc1.Cl.Cl |
| InChI | InChI=1S/C29H43N5O3S.2ClH/c1-33(2)19-21-13-15-22(16-14-21)20-34-17-18-38-29(34)32-31-28(37)26(35)25(23-9-5-3-6-10-23)30-27(36)24-11-7-4-8-12-24;;/h13-16,23-25H,3-12,17-20H2,1-2H3,(H,30,36)(H,31,37);2*1H |
| InChIKey | SOJWUTHATPUEIB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.68 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|