C22H36N4O3S — CID 87150073
N-[1-cyclohexyl-2,3-dioxo-3-[(2Z)-2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]propyl]cyclohexanecarboxamide (PubChem CID 87150073) has the molecular formula C22H36N4O3S and a molecular weight of 436.62 g/mol. Its IUPAC name is N-[1-cyclohexyl-2,3-dioxo-3-[(2Z)-2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]propyl]cyclohexanecarboxamide.
| Compound Name | N-[1-cyclohexyl-2,3-dioxo-3-[(2Z)-2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]propyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 87150073 |
| Molecular Formula | C22H36N4O3S |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | N-[1-cyclohexyl-2,3-dioxo-3-[(2Z)-2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]propyl]cyclohexanecarboxamide |
| SMILES | CN1/C(=N/NC(=O)C(=O)C(NC(=O)C2CCCCC2)C2CCCCC2)SCC1(C)C |
| InChI | InChI=1S/C22H36N4O3S/c1-22(2)14-30-21(26(22)3)25-24-20(29)18(27)17(15-10-6-4-7-11-15)23-19(28)16-12-8-5-9-13-16/h15-17H,4-14H2,1-3H3,(H,23,28)(H,24,29)/b25-21- |
| InChIKey | GCBVQOWUHJTVJT-DAFNUICNSA-N |
| XLogP | 3.05 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|