C21H37ClN4O3S — CID 87150159
N-[5,5-dimethyl-1,2-dioxo-1-[(2Z)-2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]hexan-3-yl]cyclohexanecarboxamide;hydrochloride (PubChem CID 87150159) has the molecular formula C21H37ClN4O3S and a molecular weight of 461.07 g/mol. Its IUPAC name is N-[5,5-dimethyl-1,2-dioxo-1-[(2Z)-2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]hexan-3-yl]cyclohexanecarboxamide;hydrochloride.
| Compound Name | N-[5,5-dimethyl-1,2-dioxo-1-[(2Z)-2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]hexan-3-yl]cyclohexanecarboxamide;hydrochloride |
|---|---|
| PubChem CID | 87150159 |
| Molecular Formula | C21H37ClN4O3S |
| Molecular Weight | 461.07 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | N-[5,5-dimethyl-1,2-dioxo-1-[(2Z)-2-(3,4,4-trimethyl-1,3-thiazolidin-2-ylidene)hydrazinyl]hexan-3-yl]cyclohexanecarboxamide;hydrochloride |
| SMILES | CN1/C(=N/NC(=O)C(=O)C(CC(C)(C)C)NC(=O)C2CCCCC2)SCC1(C)C.Cl |
| InChI | InChI=1S/C21H36N4O3S.ClH/c1-20(2,3)12-15(22-17(27)14-10-8-7-9-11-14)16(26)18(28)23-24-19-25(6)21(4,5)13-29-19;/h14-15H,7-13H2,1-6H3,(H,22,27)(H,23,28);1H/b24-19-; |
| InChIKey | PIMDHIDVAJQZOH-BMGIYVBOSA-N |
| XLogP | 3.32 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.07 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|