C24H32F3N3O3 — CID 87150262
N-[5,5-dimethyl-1,2-dioxo-1-[(2E)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]hexan-3-yl]cyclohexanecarboxamide (PubChem CID 87150262) has the molecular formula C24H32F3N3O3 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[5,5-dimethyl-1,2-dioxo-1-[(2E)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]hexan-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[5,5-dimethyl-1,2-dioxo-1-[(2E)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]hexan-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 87150262 |
| Molecular Formula | C24H32F3N3O3 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | N-[5,5-dimethyl-1,2-dioxo-1-[(2E)-2-[1-[3-(trifluoromethyl)phenyl]ethylidene]hydrazinyl]hexan-3-yl]cyclohexanecarboxamide |
| SMILES | C/C(=N\NC(=O)C(=O)C(CC(C)(C)C)NC(=O)C1CCCCC1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H32F3N3O3/c1-15(17-11-8-12-18(13-17)24(25,26)27)29-30-22(33)20(31)19(14-23(2,3)4)28-21(32)16-9-6-5-7-10-16/h8,11-13,16,19H,5-7,9-10,14H2,1-4H3,(H,28,32)(H,30,33)/b29-15+ |
| InChIKey | VERVXRQXKWJQFJ-WKULSOCRSA-N |
| XLogP | 4.62 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|