C19H29N3O5 — CID 90869513
N-[1-[(2,5-dihydroxypyrrol-1-yl)amino]-5,5-dimethyl-1,2-dioxohexan-3-yl]cyclohexanecarboxamide (PubChem CID 90869513) has the molecular formula C19H29N3O5 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[1-[(2,5-dihydroxypyrrol-1-yl)amino]-5,5-dimethyl-1,2-dioxohexan-3-yl]cyclohexanecarboxamide.
| Compound Name | N-[1-[(2,5-dihydroxypyrrol-1-yl)amino]-5,5-dimethyl-1,2-dioxohexan-3-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 90869513 |
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | N-[1-[(2,5-dihydroxypyrrol-1-yl)amino]-5,5-dimethyl-1,2-dioxohexan-3-yl]cyclohexanecarboxamide |
| SMILES | CC(C)(C)CC(NC(=O)C1CCCCC1)C(=O)C(=O)Nn1c(O)ccc1O |
| InChI | InChI=1S/C19H29N3O5/c1-19(2,3)11-13(20-17(26)12-7-5-4-6-8-12)16(25)18(27)21-22-14(23)9-10-15(22)24/h9-10,12-13,23-24H,4-8,11H2,1-3H3,(H,20,26)(H,21,27) |
| InChIKey | GJWGSTVCWDQHPC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|