C24H29N7O6S — CID 66784428
methyl N-[1-[2-[[(3S)-4-methyl-1-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxopentan-3-yl]amino]-2-oxoethyl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate (PubChem CID 66784428) has the molecular formula C24H29N7O6S and a molecular weight of 543.61 g/mol. Its IUPAC name is methyl N-[1-[2-[[(3S)-4-methyl-1-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxopentan-3-yl]amino]-2-oxoethyl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate.
| Compound Name | methyl N-[1-[2-[[(3S)-4-methyl-1-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxopentan-3-yl]amino]-2-oxoethyl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate |
|---|---|
| PubChem CID | 66784428 |
| Molecular Formula | C24H29N7O6S |
| Molecular Weight | 543.61 g/mol |
| Exact Mass | 543.19 |
| IUPAC Name | methyl N-[1-[2-[[(3S)-4-methyl-1-[2-(3-methyl-1,3-thiazolidin-2-ylidene)hydrazinyl]-1,2-dioxopentan-3-yl]amino]-2-oxoethyl]-6-oxo-2-phenylpyrimidin-5-yl]carbamate |
| SMILES | COC(=O)Nc1cnc(-c2ccccc2)n(CC(=O)N[C@H](C(=O)C(=O)NN=C2SCCN2C)C(C)C)c1=O |
| InChI | InChI=1S/C24H29N7O6S/c1-14(2)18(19(33)21(34)28-29-23-30(3)10-11-38-23)27-17(32)13-31-20(15-8-6-5-7-9-15)25-12-16(22(31)35)26-24(36)37-4/h5-9,12,14,18H,10-11,13H2,1-4H3,(H,26,36)(H,27,32)(H,28,34)/t18-/m0/s1 |
| InChIKey | IGONPXGWVZGHCK-SFHVURJKSA-N |
| XLogP | 0.86 |
| TPSA | 164.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.61 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|