C21H31N5O3 — CID 66786411
(3R)-3-amino-1-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-8-nitrononan-1-one (PubChem CID 66786411) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is (3R)-3-amino-1-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-8-nitrononan-1-one.
| Compound Name | (3R)-3-amino-1-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-8-nitrononan-1-one |
|---|---|
| PubChem CID | 66786411 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | (3R)-3-amino-1-[3-(1H-benzimidazol-2-yl)piperidin-1-yl]-8-nitrononan-1-one |
| SMILES | CC(CCCC[C@@H](N)CC(=O)N1CCCC(c2nc3ccccc3[nH]2)C1)[N+](=O)[O-] |
| InChI | InChI=1S/C21H31N5O3/c1-15(26(28)29)7-2-3-9-17(22)13-20(27)25-12-6-8-16(14-25)21-23-18-10-4-5-11-19(18)24-21/h4-5,10-11,15-17H,2-3,6-9,12-14,22H2,1H3,(H,23,24)/t15?,16?,17-/m1/s1 |
| InChIKey | UEGNVZWDHXBRHB-OFLPRAFFSA-N |
| XLogP | 3.21 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|