C26H29N3O4 — CID 66787494
(E)-but-2-enedioic acid;N-[3-(1H-indol-5-yl)phenyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 66787494) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-[3-(1H-indol-5-yl)phenyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | (E)-but-2-enedioic acid;N-[3-(1H-indol-5-yl)phenyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 66787494 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | (E)-but-2-enedioic acid;N-[3-(1H-indol-5-yl)phenyl]-8-methyl-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CN1C2CCC1CC(Nc1cccc(-c3ccc4[nH]ccc4c3)c1)C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H25N3.C4H4O4/c1-25-20-6-7-21(25)14-19(13-20)24-18-4-2-3-15(12-18)16-5-8-22-17(11-16)9-10-23-22;5-3(6)1-2-4(7)8/h2-5,8-12,19-21,23-24H,6-7,13-14H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | IBMSYGCGNLICKO-WLHGVMLRSA-N |
| XLogP | 4.58 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|