C27H31N3O4 — CID 66788127
(E)-but-2-enedioic acid;(1R,5S)-8-methyl-N-[4-(1-methylindol-5-yl)phenyl]-8-azabicyclo[3.2.1]octan-3-amine (PubChem CID 66788127) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;(1R,5S)-8-methyl-N-[4-(1-methylindol-5-yl)phenyl]-8-azabicyclo[3.2.1]octan-3-amine.
| Compound Name | (E)-but-2-enedioic acid;(1R,5S)-8-methyl-N-[4-(1-methylindol-5-yl)phenyl]-8-azabicyclo[3.2.1]octan-3-amine |
|---|---|
| PubChem CID | 66788127 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (E)-but-2-enedioic acid;(1R,5S)-8-methyl-N-[4-(1-methylindol-5-yl)phenyl]-8-azabicyclo[3.2.1]octan-3-amine |
| SMILES | CN1[C@@H]2CC[C@H]1CC(Nc1ccc(-c3ccc4c(ccn4C)c3)cc1)C2.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C23H27N3.C4H4O4/c1-25-12-11-18-13-17(5-10-23(18)25)16-3-6-19(7-4-16)24-20-14-21-8-9-22(15-20)26(21)2;5-3(6)1-2-4(7)8/h3-7,10-13,20-22,24H,8-9,14-15H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t20?,21-,22+; |
| InChIKey | LGRGNEAPLXPQDM-RDWSPKAKSA-N |
| XLogP | 4.59 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|