C23H21F5N4O — CID 66788112
1'-[3-(cyclopropylmethyl)-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1,1-difluorospiro[2-benzofuran-3,4'-piperidine] (PubChem CID 66788112) has the molecular formula C23H21F5N4O and a molecular weight of 464.44 g/mol. Its IUPAC name is 1'-[3-(cyclopropylmethyl)-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1,1-difluorospiro[2-benzofuran-3,4'-piperidine].
| Compound Name | 1'-[3-(cyclopropylmethyl)-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1,1-difluorospiro[2-benzofuran-3,4'-piperidine] |
|---|---|
| PubChem CID | 66788112 |
| Molecular Formula | C23H21F5N4O |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 1'-[3-(cyclopropylmethyl)-8-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-1,1-difluorospiro[2-benzofuran-3,4'-piperidine] |
| SMILES | FC(F)(F)c1c(N2CCC3(CC2)OC(F)(F)c2ccccc23)ccn2c(CC3CC3)nnc12 |
| InChI | InChI=1S/C23H21F5N4O/c24-22(25,26)19-17(7-10-32-18(13-14-5-6-14)29-30-20(19)32)31-11-8-21(9-12-31)15-3-1-2-4-16(15)23(27,28)33-21/h1-4,7,10,14H,5-6,8-9,11-13H2 |
| InChIKey | OIQJKBMROQBFQC-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |