C9H10I2O3S — CID 66789068
1,1-diiodo-2-(4-methoxyphenyl)ethanesulfinic acid (PubChem CID 66789068) has the molecular formula C9H10I2O3S and a molecular weight of 452.05 g/mol. Its IUPAC name is 1,1-diiodo-2-(4-methoxyphenyl)ethanesulfinic acid.
| Compound Name | 1,1-diiodo-2-(4-methoxyphenyl)ethanesulfinic acid |
|---|---|
| PubChem CID | 66789068 |
| Molecular Formula | C9H10I2O3S |
| Molecular Weight | 452.05 g/mol |
| Exact Mass | 451.84 |
| IUPAC Name | 1,1-diiodo-2-(4-methoxyphenyl)ethanesulfinic acid |
| SMILES | COc1ccc(CC(I)(I)S(=O)O)cc1 |
| InChI | InChI=1S/C9H10I2O3S/c1-14-8-4-2-7(3-5-8)6-9(10,11)15(12)13/h2-5H,6H2,1H3,(H,12,13) |
| InChIKey | ZIGVSYZIZYYRIX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.05 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|