C14H17N7O2 — CID 66792158
4-amino-2-[4-[[2-(methylamino)-2-oxoethyl]amino]anilino]pyrimidine-5-carboxamide (PubChem CID 66792158) has the molecular formula C14H17N7O2 and a molecular weight of 315.34 g/mol. Its IUPAC name is 4-amino-2-[4-[[2-(methylamino)-2-oxoethyl]amino]anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-[4-[[2-(methylamino)-2-oxoethyl]amino]anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66792158 |
| Molecular Formula | C14H17N7O2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 4-amino-2-[4-[[2-(methylamino)-2-oxoethyl]amino]anilino]pyrimidine-5-carboxamide |
| SMILES | CNC(=O)CNc1ccc(Nc2ncc(C(N)=O)c(N)n2)cc1 |
| InChI | InChI=1S/C14H17N7O2/c1-17-11(22)7-18-8-2-4-9(5-3-8)20-14-19-6-10(13(16)23)12(15)21-14/h2-6,18H,7H2,1H3,(H2,16,23)(H,17,22)(H3,15,19,20,21) |
| InChIKey | YGMNGLNYDYQTFS-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 148.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |