C27H20ClN3O2 — CID 66792935
(E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid (PubChem CID 66792935) has the molecular formula C27H20ClN3O2 and a molecular weight of 453.93 g/mol. Its IUPAC name is (E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66792935 |
| Molecular Formula | C27H20ClN3O2 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | (E)-3-[4-[(E)-2-(2-chloro-4-cyanophenyl)-1-(1H-indazol-5-yl)but-1-enyl]phenyl]prop-2-enoic acid |
| SMILES | CC/C(=C(/c1ccc(/C=C/C(=O)O)cc1)c1ccc2[nH]ncc2c1)c1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C27H20ClN3O2/c1-2-22(23-10-5-18(15-29)13-24(23)28)27(20-9-11-25-21(14-20)16-30-31-25)19-7-3-17(4-8-19)6-12-26(32)33/h3-14,16H,2H2,1H3,(H,30,31)(H,32,33)/b12-6+,27-22+ |
| InChIKey | VEOABZQSUJRZEG-KDPSZLDMSA-N |
| XLogP | 6.55 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|