About 1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane
1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane (PubChem CID 66796064) has the molecular formula C8H12F4OS
and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane.
Analyze 1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane?
The IUPAC name of 1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane (CID 66796064) is 1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane.
What is the SMILES notation for 1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane?
The canonical SMILES for 1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane is O=S(CC(F)(F)F)C1CCC(F)CC1.
What is the InChIKey of 1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane?
The InChIKey is DIVJACDPMOCCOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F4OS/c9-6-1-3-7(4-2-6)14(13)5-8(10,11)12/h6-7H,1-5H2.
What are the key properties of 1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane?
1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane has a molecular weight of 232.24 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-(2,2,2-trifluoroethylsulfinyl)cyclohexane is sourced from PubChem (CID 66796064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).