C8H12F4O2S — CID 66796303
1-fluoro-2-(2,2,2-trifluoroethylsulfonyl)cyclohexane (PubChem CID 66796303) has the molecular formula C8H12F4O2S and a molecular weight of 248.24 g/mol. Its IUPAC name is 1-fluoro-2-(2,2,2-trifluoroethylsulfonyl)cyclohexane.
| Compound Name | 1-fluoro-2-(2,2,2-trifluoroethylsulfonyl)cyclohexane |
|---|---|
| PubChem CID | 66796303 |
| Molecular Formula | C8H12F4O2S |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 1-fluoro-2-(2,2,2-trifluoroethylsulfonyl)cyclohexane |
| SMILES | O=S(=O)(CC(F)(F)F)C1CCCCC1F |
| InChI | InChI=1S/C8H12F4O2S/c9-6-3-1-2-4-7(6)15(13,14)5-8(10,11)12/h6-7H,1-5H2 |
| InChIKey | ORCDEXJFZNTJBY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |