C9H12F8O2S — CID 57425674
1,1,1,2,2-pentafluoro-5-(3,3,3-trifluoropropylsulfonyl)hexane (PubChem CID 57425674) has the molecular formula C9H12F8O2S and a molecular weight of 336.24 g/mol. Its IUPAC name is 1,1,1,2,2-pentafluoro-5-(3,3,3-trifluoropropylsulfonyl)hexane.
| Compound Name | 1,1,1,2,2-pentafluoro-5-(3,3,3-trifluoropropylsulfonyl)hexane |
|---|---|
| PubChem CID | 57425674 |
| Molecular Formula | C9H12F8O2S |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | 1,1,1,2,2-pentafluoro-5-(3,3,3-trifluoropropylsulfonyl)hexane |
| SMILES | CC(CCC(F)(F)C(F)(F)F)S(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C9H12F8O2S/c1-6(2-3-7(10,11)9(15,16)17)20(18,19)5-4-8(12,13)14/h6H,2-5H2,1H3 |
| InChIKey | USTSJCULEGGONC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|