About CID 66797463
CID 66797463 (PubChem CID 66797463) has the molecular formula C13H14Si
and a molecular weight of 198.34 g/mol.
Molecular Properties
| Compound Name | CID 66797463 |
| PubChem CID | 66797463 |
| Molecular Formula | C13H14Si |
| Molecular Weight | 198.34 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | — |
| SMILES | CC(C)[Si]c1cccc2ccccc12 |
| InChI | InChI=1S/C13H14Si/c1-10(2)14-13-9-5-7-11-6-3-4-8-12(11)13/h3-10H,1-2H3 |
| InChIKey | ISPRGWMBQGDJQR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66797463 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66797463?
The IUPAC name of CID 66797463 (CID 66797463) is not available.
What is the SMILES notation for CID 66797463?
The canonical SMILES for CID 66797463 is CC(C)[Si]c1cccc2ccccc12.
What is the InChIKey of CID 66797463?
The InChIKey is ISPRGWMBQGDJQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Si/c1-10(2)14-13-9-5-7-11-6-3-4-8-12(11)13/h3-10H,1-2H3.
What are the key properties of CID 66797463?
CID 66797463 has a molecular weight of 198.34 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66797463 is sourced from PubChem (CID 66797463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).