About Naphthylsilanol
Naphthylsilanol (PubChem CID 56991387) has the molecular formula C10H8OSi
and a molecular weight of 172.26 g/mol.
Molecular Properties
| Compound Name | Naphthylsilanol |
| PubChem CID | 56991387 |
| Molecular Formula | C10H8OSi |
| Molecular Weight | 172.26 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | — |
| SMILES | O[Si]c1cccc2ccccc12 |
| InChI | InChI=1S/C10H8OSi/c11-12-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H |
| InChIKey | RFZAQTSOYFXCCQ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Naphthylsilanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Naphthylsilanol?
The IUPAC name of Naphthylsilanol (CID 56991387) is not available.
What is the SMILES notation for Naphthylsilanol?
The canonical SMILES for Naphthylsilanol is O[Si]c1cccc2ccccc12.
What is the InChIKey of Naphthylsilanol?
The InChIKey is RFZAQTSOYFXCCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8OSi/c11-12-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H.
What are the key properties of Naphthylsilanol?
Naphthylsilanol has a molecular weight of 172.26 g/mol, XLogP of 1.08, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Naphthylsilanol is sourced from PubChem (CID 56991387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).