C32H34N4O6S — CID 6680819
[(2S)-1-[[4-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-5-phenyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-1-oxopropan-2-yl] acetate (PubChem CID 6680819) has the molecular formula C32H34N4O6S and a molecular weight of 602.71 g/mol. Its IUPAC name is [(2S)-1-[[4-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-5-phenyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-1-oxopropan-2-yl] acetate.
| Compound Name | [(2S)-1-[[4-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-5-phenyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 6680819 |
| Molecular Formula | C32H34N4O6S |
| Molecular Weight | 602.71 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | [(2S)-1-[[4-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-5-phenyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)C(=O)NCc1ccc(C2O[C@H](CSc3ncn[nH]3)[C@@H](c3ccccc3)[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C32H34N4O6S/c1-20(40-21(2)38)30(39)33-16-22-8-14-26(15-9-22)31-41-27(18-43-32-34-19-35-36-32)28(24-6-4-3-5-7-24)29(42-31)25-12-10-23(17-37)11-13-25/h3-15,19-20,27-29,31,37H,16-18H2,1-2H3,(H,33,39)(H,34,35,36)/t20-,27+,28+,29-,31?/m0/s1 |
| InChIKey | RPTMLTJVHOYEJZ-PTGWSMBQSA-N |
| XLogP | 4.60 |
| TPSA | 135.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.71 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |