C37H37N5O5S — CID 6681154
1-[3-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-5-phenyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-3-[(2R)-3-oxo-1-phenylbutan-2-yl]urea (PubChem CID 6681154) has the molecular formula C37H37N5O5S and a molecular weight of 663.80 g/mol. Its IUPAC name is 1-[3-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-5-phenyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-3-[(2R)-3-oxo-1-phenylbutan-2-yl]urea.
| Compound Name | 1-[3-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-5-phenyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-3-[(2R)-3-oxo-1-phenylbutan-2-yl]urea |
|---|---|
| PubChem CID | 6681154 |
| Molecular Formula | C37H37N5O5S |
| Molecular Weight | 663.80 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | 1-[3-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-5-phenyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]-3-[(2R)-3-oxo-1-phenylbutan-2-yl]urea |
| SMILES | CC(=O)[C@@H](Cc1ccccc1)NC(=O)Nc1cccc(C2O[C@H](CSc3ncn[nH]3)[C@@H](c3ccccc3)[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C37H37N5O5S/c1-24(44)31(19-25-9-4-2-5-10-25)41-36(45)40-30-14-8-13-29(20-30)35-46-32(22-48-37-38-23-39-42-37)33(27-11-6-3-7-12-27)34(47-35)28-17-15-26(21-43)16-18-28/h2-18,20,23,31-35,43H,19,21-22H2,1H3,(H,38,39,42)(H2,40,41,45)/t31-,32-,33-,34+,35?/m1/s1 |
| InChIKey | OOEAFCQXCMIZNS-UYHMGNQRSA-N |
| XLogP | 6.35 |
| TPSA | 138.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.80 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |