C27H32N4O6S — CID 6687876
5-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 6687876) has the molecular formula C27H32N4O6S and a molecular weight of 540.64 g/mol. Its IUPAC name is 5-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6687876 |
| Molecular Formula | C27H32N4O6S |
| Molecular Weight | 540.64 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 5-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | C[C@H]1C(c2ccc(CO)cc2)O[C@@H](c2ccc(CNC(=O)CCCC(=O)O)cc2)O[C@H]1CSc1ncn[nH]1 |
| InChI | InChI=1S/C27H32N4O6S/c1-17-22(15-38-27-29-16-30-31-27)36-26(37-25(17)20-9-7-19(14-32)8-10-20)21-11-5-18(6-12-21)13-28-23(33)3-2-4-24(34)35/h5-12,16-17,22,25-26,32H,2-4,13-15H2,1H3,(H,28,33)(H,34,35)(H,29,30,31)/t17-,22+,25?,26+/m1/s1 |
| InChIKey | UBFRFFVHEHASKE-PCYOSGLOSA-N |
| XLogP | 3.75 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.64 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |