C21H24N4O3S — CID 6680498
[4-[(4R,5R,6S)-2-(3-aminophenyl)-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6680498) has the molecular formula C21H24N4O3S and a molecular weight of 412.52 g/mol. Its IUPAC name is [4-[(4R,5R,6S)-2-(3-aminophenyl)-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(4R,5R,6S)-2-(3-aminophenyl)-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6680498 |
| Molecular Formula | C21H24N4O3S |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [4-[(4R,5R,6S)-2-(3-aminophenyl)-5-methyl-6-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)OC(c2cccc(N)c2)O[C@@H]1CSc1ncn[nH]1 |
| InChI | InChI=1S/C21H24N4O3S/c1-13-18(11-29-21-23-12-24-25-21)27-20(16-3-2-4-17(22)9-16)28-19(13)15-7-5-14(10-26)6-8-15/h2-9,12-13,18-20,26H,10-11,22H2,1H3,(H,23,24,25)/t13-,18+,19?,20?/m0/s1 |
| InChIKey | SZLDGTQXSZWEHJ-UKJJHFOQSA-N |
| XLogP | 3.46 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|