C21H22ClN3O3S2 — CID 66808373
tert-butyl N-[4-[2-amino-4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]sulfanylphenyl]carbamate (PubChem CID 66808373) has the molecular formula C21H22ClN3O3S2 and a molecular weight of 464.01 g/mol. Its IUPAC name is tert-butyl N-[4-[2-amino-4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]sulfanylphenyl]carbamate.
| Compound Name | tert-butyl N-[4-[2-amino-4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]sulfanylphenyl]carbamate |
|---|---|
| PubChem CID | 66808373 |
| Molecular Formula | C21H22ClN3O3S2 |
| Molecular Weight | 464.01 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | tert-butyl N-[4-[2-amino-4-[(2-chloro-1,3-thiazol-5-yl)methoxy]phenyl]sulfanylphenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(Sc2ccc(OCc3cnc(Cl)s3)cc2N)cc1 |
| InChI | InChI=1S/C21H22ClN3O3S2/c1-21(2,3)28-20(26)25-13-4-7-15(8-5-13)29-18-9-6-14(10-17(18)23)27-12-16-11-24-19(22)30-16/h4-11H,12,23H2,1-3H3,(H,25,26) |
| InChIKey | KWSCSQHWILATPH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.01 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|