C42H46N4O7 — CID 6681402
[(2S)-1-[3-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-5-phenyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate (PubChem CID 6681402) has the molecular formula C42H46N4O7 and a molecular weight of 718.85 g/mol. Its IUPAC name is [(2S)-1-[3-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-5-phenyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate.
| Compound Name | [(2S)-1-[3-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-5-phenyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 6681402 |
| Molecular Formula | C42H46N4O7 |
| Molecular Weight | 718.85 g/mol |
| Exact Mass | 718.34 |
| IUPAC Name | [(2S)-1-[3-[(4R,5S,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-8-yl)methyl]-5-phenyl-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)C(=O)Nc1cccc(C2O[C@H](CN3CCC4(CC3)C(=O)NCN4c3ccccc3)[C@@H](c3ccccc3)[C@H](c3ccc(CO)cc3)O2)c1 |
| InChI | InChI=1S/C42H46N4O7/c1-28(51-29(2)48)39(49)44-34-13-9-12-33(24-34)40-52-36(37(31-10-5-3-6-11-31)38(53-40)32-18-16-30(26-47)17-19-32)25-45-22-20-42(21-23-45)41(50)43-27-46(42)35-14-7-4-8-15-35/h3-19,24,28,36-38,40,47H,20-23,25-27H2,1-2H3,(H,43,50)(H,44,49)/t28-,36+,37+,38-,40?/m0/s1 |
| InChIKey | YSJKVYOYTKODNX-AXDRFRQTSA-N |
| XLogP | 5.44 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.85 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |