C39H44N2O7S — CID 6681726
methyl (2S)-2-[[2-[4-[(2S,4S,5R,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate (PubChem CID 6681726) has the molecular formula C39H44N2O7S and a molecular weight of 684.86 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[4-[(2S,4S,5R,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[2-[4-[(2S,4S,5R,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6681726 |
| Molecular Formula | C39H44N2O7S |
| Molecular Weight | 684.86 g/mol |
| Exact Mass | 684.29 |
| IUPAC Name | methyl (2S)-2-[[2-[4-[(2S,4S,5R,6R)-4-(2-hydroxyethylsulfanylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)NCc1ccccc1-c1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSCCO)O2)cc1 |
| InChI | InChI=1S/C39H44N2O7S/c1-26-35(25-49-21-20-42)47-38(48-36(26)30-14-12-28(24-43)13-15-30)31-18-16-29(17-19-31)33-11-7-6-10-32(33)23-40-39(45)41-34(37(44)46-2)22-27-8-4-3-5-9-27/h3-19,26,34-36,38,42-43H,20-25H2,1-2H3,(H2,40,41,45)/t26-,34-,35+,36?,38+/m0/s1 |
| InChIKey | AEWBKWVABFOUBE-CMQQOWARSA-N |
| XLogP | 5.95 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.86 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|