C25H21N3O3 — CID 66818676
3,5-bis(4-cyanophenoxy)-N,N-diethylbenzamide (PubChem CID 66818676) has the molecular formula C25H21N3O3 and a molecular weight of 411.46 g/mol. Its IUPAC name is 3,5-bis(4-cyanophenoxy)-N,N-diethylbenzamide.
| Compound Name | 3,5-bis(4-cyanophenoxy)-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 66818676 |
| Molecular Formula | C25H21N3O3 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 3,5-bis(4-cyanophenoxy)-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cc(Oc2ccc(C#N)cc2)cc(Oc2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C25H21N3O3/c1-3-28(4-2)25(29)20-13-23(30-21-9-5-18(16-26)6-10-21)15-24(14-20)31-22-11-7-19(17-27)8-12-22/h5-15H,3-4H2,1-2H3 |
| InChIKey | TZCAKLGKDGQDSY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |