C25H27N5O5 — CID 91285588
N,N-diethyl-3,5-bis[4-(N'-hydroxycarbamimidoyl)phenoxy]benzamide (PubChem CID 91285588) has the molecular formula C25H27N5O5 and a molecular weight of 477.52 g/mol. Its IUPAC name is N,N-diethyl-3,5-bis[4-(N'-hydroxycarbamimidoyl)phenoxy]benzamide.
| Compound Name | N,N-diethyl-3,5-bis[4-(N'-hydroxycarbamimidoyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 91285588 |
| Molecular Formula | C25H27N5O5 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | N,N-diethyl-3,5-bis[4-(N'-hydroxycarbamimidoyl)phenoxy]benzamide |
| SMILES | CCN(CC)C(=O)c1cc(Oc2ccc(C(N)=NO)cc2)cc(Oc2ccc(C(N)=NO)cc2)c1 |
| InChI | InChI=1S/C25H27N5O5/c1-3-30(4-2)25(31)18-13-21(34-19-9-5-16(6-10-19)23(26)28-32)15-22(14-18)35-20-11-7-17(8-12-20)24(27)29-33/h5-15,32-33H,3-4H2,1-2H3,(H2,26,28)(H2,27,29) |
| InChIKey | BTRIEVIJVVIOLU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 155.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|