C24H21FN4O2S — CID 66819670
N-[3-fluoro-4-(4-oxopiperidin-1-yl)phenyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 66819670) has the molecular formula C24H21FN4O2S and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[3-fluoro-4-(4-oxopiperidin-1-yl)phenyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-[3-fluoro-4-(4-oxopiperidin-1-yl)phenyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 66819670 |
| Molecular Formula | C24H21FN4O2S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-[3-fluoro-4-(4-oxopiperidin-1-yl)phenyl]-3-methyl-1-phenylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)c2sc(C(=O)Nc3ccc(N4CCC(=O)CC4)c(F)c3)cc12 |
| InChI | InChI=1S/C24H21FN4O2S/c1-15-19-14-22(32-24(19)29(27-15)17-5-3-2-4-6-17)23(31)26-16-7-8-21(20(25)13-16)28-11-9-18(30)10-12-28/h2-8,13-14H,9-12H2,1H3,(H,26,31) |
| InChIKey | SKVYBOSDQQFGCD-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|