C27H37N5O — CID 66819710
5-[[4-[2-[benzyl(methyl)amino]ethoxy]phenyl]methyl]-6-methyl-2-N-pentylpyrimidine-2,4-diamine (PubChem CID 66819710) has the molecular formula C27H37N5O and a molecular weight of 447.63 g/mol. Its IUPAC name is 5-[[4-[2-[benzyl(methyl)amino]ethoxy]phenyl]methyl]-6-methyl-2-N-pentylpyrimidine-2,4-diamine.
| Compound Name | 5-[[4-[2-[benzyl(methyl)amino]ethoxy]phenyl]methyl]-6-methyl-2-N-pentylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 66819710 |
| Molecular Formula | C27H37N5O |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.30 |
| IUPAC Name | 5-[[4-[2-[benzyl(methyl)amino]ethoxy]phenyl]methyl]-6-methyl-2-N-pentylpyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(C)c(Cc2ccc(OCCN(C)Cc3ccccc3)cc2)c(N)n1 |
| InChI | InChI=1S/C27H37N5O/c1-4-5-9-16-29-27-30-21(2)25(26(28)31-27)19-22-12-14-24(15-13-22)33-18-17-32(3)20-23-10-7-6-8-11-23/h6-8,10-15H,4-5,9,16-20H2,1-3H3,(H3,28,29,30,31) |
| InChIKey | BLTKUPPIEJBBPY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|